CAS 13230-43-8
:2-Methyl-5-nitro-1-(2-propen-1-yl)-1H-imidazole
Description:
2-Methyl-5-nitro-1-(2-propen-1-yl)-1H-imidazole, with the CAS number 13230-43-8, is an organic compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a methyl group and a nitro group at specific positions on the imidazole ring, contributing to its chemical reactivity and potential applications. The presence of the propenyl group indicates that it has unsaturation, which can facilitate various chemical reactions, such as polymerization or addition reactions. The nitro group is known for its electron-withdrawing properties, which can influence the compound's reactivity and stability. This substance may exhibit biological activity, making it of interest in pharmaceutical research. Its solubility, melting point, and other physical properties would depend on the specific conditions and the presence of solvents. Overall, 2-Methyl-5-nitro-1-(2-propen-1-yl)-1H-imidazole is a versatile compound with potential applications in organic synthesis and medicinal chemistry.
Formula:C7H9N3O2
InChI:InChI=1S/C7H9N3O2/c1-3-4-9-6(2)8-5-7(9)10(11)12/h3,5H,1,4H2,2H3
InChI key:InChIKey=FRPCZQWGVIAXPC-UHFFFAOYSA-N
SMILES:C(C=C)N1C(N(=O)=O)=CN=C1C
Synonyms:- 1H-Imidazole, 2-methyl-5-nitro-1-(2-propenyl)-
- 1H-Imidazole, 2-methyl-5-nitro-1-(2-propen-1-yl)-
- 2-Methyl-5-nitro-1-(2-propen-1-yl)-1H-imidazole
- Imidazole, 1-allyl-2-methyl-5-nitro-
- 1-Allyl-2-methyl-5-nitroimidazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
