CAS 13230-99-4
:7,9-Dihydro-2H-purine-2,8(3H)-dione
Description:
7,9-Dihydro-2H-purine-2,8(3H)-dione, also known as hypoxanthine, is a purine derivative characterized by its bicyclic structure, which consists of a fused imidazole and pyrimidine ring. This compound is a naturally occurring nucleobase found in various biological systems and plays a crucial role in the metabolism of nucleotides. Hypoxanthine is involved in the purine salvage pathway, where it is converted into xanthine and subsequently into uric acid. It is soluble in water and exhibits moderate stability under physiological conditions. The compound has a molecular formula that reflects its heterocyclic nature, containing nitrogen and oxygen atoms, which contribute to its reactivity and biological functions. Hypoxanthine is also of interest in medical research, particularly in studies related to cellular metabolism, oxidative stress, and as a potential biomarker for certain diseases. Its CAS number, 13230-99-4, is used for identification in chemical databases and regulatory contexts.
Formula:C5H4N4O2
InChI:InChI=1S/C5H4N4O2/c10-4-6-1-2-3(8-4)9-5(11)7-2/h1H,(H3,6,7,8,9,10,11)
InChI key:InChIKey=PRUGQYWGIVNHEM-UHFFFAOYSA-N
SMILES:O=C1NC2=C(N1)NC(=O)N=C2
Synonyms:- 1H-Purine-2,8(3H,7H)-dione
- 2H-Purine-2,8(3H)-dione, 7,9-dihydro-
- Purine-2,8-diol
- 7,9-Dihydro-2H-purine-2,8(3H)-dione
- 2,8-Dihydroxypurine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
