CAS 132305-66-9

BD 623

Description:

BD 623, with the CAS number 132305-66-9, is a chemical compound that has garnered interest in the field of medicinal chemistry, particularly for its potential therapeutic applications. It is classified as a selective inhibitor of certain protein kinases, which play crucial roles in various cellular processes, including cell growth, differentiation, and metabolism. The compound exhibits a specific mechanism of action that targets particular signaling pathways, making it a candidate for research in cancer treatment and other diseases characterized by dysregulated kinase activity. BD 623 is typically characterized by its molecular structure, which includes specific functional groups that contribute to its biological activity and solubility properties. Additionally, its pharmacokinetic profile, including absorption, distribution, metabolism, and excretion (ADME), is essential for understanding its efficacy and safety in potential therapeutic applications. As with many investigational compounds, ongoing studies are necessary to fully elucidate its biological effects and therapeutic potential.

Formula: C₂₂H₁₈FN₇O₆

InChI: InChI=1/C22H18FN7O6/c1-28-10-17-20(25-11-29(17)15-5-3-12(23)9-13(15)21(28)31)22(32)35-8-2-7-24-14-4-6-16(30(33)34)19-18(14)26-36-27-19/h3-6,9,11,24H,2,7-8,10H2,1H3

SMILES: CN1Cc2c(C(=O)OCCCNc3ccc(c4c3non4)N(=O)=O)ncn2c2ccc(cc2C1=O)F

Synonyms:

• 4H-Imidazo(1,5-a)(1,4)benzodiazepine-3-carboxylic acid, 8-fluoro-5,6-dihydro-5-methyl-6-oxo-, 3-((7-nitro-4-benzofurazanyl)amino)propyl ester
• 3-[(7-nitro-2,1,3-benzoxadiazol-4-yl)amino]propyl 8-fluoro-5-methyl-6-oxo-5,6-dihydro-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate
• BD-623