CAS 132308-19-1
:5-Chloropyridine-2-carboxylic acid methyl ester
Description:
5-Chloropyridine-2-carboxylic acid methyl ester is an organic compound characterized by its pyridine ring, which is substituted with a chlorine atom and a carboxylic acid methyl ester functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It has a molecular formula that reflects the presence of chlorine, carbon, hydrogen, and oxygen atoms, contributing to its unique chemical properties. The presence of the chlorine atom enhances its reactivity, making it useful in various chemical syntheses, particularly in the pharmaceutical and agrochemical industries. The methyl ester group provides a degree of polarity, influencing its solubility in organic solvents. Additionally, this compound may exhibit biological activity, which can be explored in medicinal chemistry. Its synthesis and handling require standard laboratory safety protocols due to potential hazards associated with chlorinated compounds. Overall, 5-Chloropyridine-2-carboxylic acid methyl ester serves as a valuable intermediate in organic synthesis and research applications.
Formula:C7H6ClNO2
InChI:InChI=1/C7H6ClNO2/c1-11-7(10)6-3-2-5(8)4-9-6/h2-4H,1H3
SMILES:COC(=O)c1ccc(cn1)Cl
Synonyms:- 2-Pyridinecarboxylic Acid, 5-Chloro-, Methyl Ester
- 5-Chloropyridine-2-carboxylicacidmethylester
- Methyl 5-chloropyridine-2-carboxylate
- 5-Chloropyridine-2-carboxylic acid methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Pyridinecarboxylic acid, 5-chloro-, methyl ester
CAS:Formula:C7H6ClNO2Purity:97%Color and Shape:SolidMolecular weight:171.5810Methyl 5-chloro-2-pyridinecarboxylate
CAS:Methyl 5-chloro-2-pyridinecarboxylateFormula:C7H6ClNO2Purity:97%Color and Shape: off white powderMolecular weight:171.58g/mol5-Chloro-2-pyridinecarboxylic acid methyl ester
CAS:5-Chloro-2-pyridinecarboxylic acid methyl ester is a monophosphate nucleoside that can be used in the synthesis of DNA and RNA. It is also an antiviral, anticancer, and anticoagulant agent. 5-Chloro-2-pyridinecarboxylic acid methyl ester has been shown to inhibit DNA replication and transcription by inhibiting the activity of enzymes involved in these processes. It can be used as a building block for the synthesis of DNA and RNA. The purity of this product is high, with no detectable impurities at levels above 0.1%.Formula:C7H6ClNO2Purity:Min. 95%Color and Shape:PowderMolecular weight:171.58 g/molMethyl 5-chloropyridine-2-carboxylate
CAS:Formula:C7H6ClNO2Purity:95%Color and Shape:SolidMolecular weight:171.58



