CymitQuimica logo

CAS 132327-97-0

:

5-Nitro-2,1-benzisothiazole-3-diazonium

Description:
5-Nitro-2,1-benzisothiazole-3-diazonium is a chemical compound characterized by its diazonium functional group, which is known for its reactivity and utility in organic synthesis, particularly in azo coupling reactions. This compound features a nitro group, which can influence its electronic properties and reactivity. The presence of the benzisothiazole moiety contributes to its stability and potential applications in dye chemistry and materials science. As a diazonium salt, it is typically generated in situ and is sensitive to heat and light, making it necessary to handle it under controlled conditions to prevent decomposition. The compound may exhibit various physical properties, including solubility in polar solvents, and its reactivity can be exploited in the synthesis of azo dyes and other complex organic molecules. Safety precautions are essential when working with diazonium compounds due to their potential hazards, including toxicity and explosive nature under certain conditions. Overall, 5-Nitro-2,1-benzisothiazole-3-diazonium serves as a valuable intermediate in synthetic organic chemistry.
Formula:C7H3N4O2S
InChI:InChI=1S/C7H3N4O2S/c8-9-7-5-3-4(11(12)13)1-2-6(5)10-14-7/h1-3H/q+1
InChI key:InChIKey=MVVIKFWGXXAETP-UHFFFAOYSA-N
SMILES:[N+](#N)C1=C2C(C=CC(N(=O)=O)=C2)=NS1
Synonyms:
  • 2,1-Benzisothiazole-3-diazonium, 5-nitro-
  • 5-Nitro-2,1-benzisothiazole-3-diazonium
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.