
CAS 132335-48-9
:3-[Methyl(phenylmethyl)amino]-1-(2-thienyl)-1-propanone
Description:
3-[Methyl(phenylmethyl)amino]-1-(2-thienyl)-1-propanone, identified by its CAS number 132335-48-9, is a synthetic organic compound characterized by its complex molecular structure. It features a propanone backbone substituted with a thienyl group and a methyl(phenylmethyl)amino moiety, which contributes to its unique chemical properties. The presence of the thienyl ring introduces aromatic characteristics, while the amino group can participate in hydrogen bonding, influencing its solubility and reactivity. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its molecular interactions could be relevant in the development of pharmaceuticals or agrochemicals. Additionally, the compound's stability, melting point, and solubility in various solvents would depend on its specific molecular interactions and the environment in which it is studied. Overall, 3-[Methyl(phenylmethyl)amino]-1-(2-thienyl)-1-propanone represents a class of compounds that can be explored for various applications in chemical research and industry.
Formula:C15H17NOS
InChI:InChI=1S/C15H17NOS/c1-16(12-13-6-3-2-4-7-13)10-9-14(17)15-8-5-11-18-15/h2-8,11H,9-10,12H2,1H3
InChI key:InChIKey=ZFHDLFSAKBZORM-UHFFFAOYSA-N
SMILES:C(CCN(CC1=CC=CC=C1)C)(=O)C2=CC=CS2
Synonyms:- 1-Propanone, 3-[methyl(phenylmethyl)amino]-1-(2-thienyl)-
- 3-[Methyl(phenylmethyl)amino]-1-(2-thienyl)-1-propanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Propanone, 3-[methyl(phenylmethyl)amino]-1-(2-thienyl)-
CAS:Formula:C15H17NOSMolecular weight:259.3666
