CymitQuimica logo

CAS 132339-20-9

:

(1S)-2,5-Diazabicyclo[2.2.1]heptane

Description:
(1S)-2,5-Diazabicyclo[2.2.1]heptane, also known as DBH, is a bicyclic organic compound characterized by its unique structure that features two nitrogen atoms incorporated into a bicyclic framework. This compound is a member of the diazabicycloalkane family and is notable for its potential applications in organic synthesis and as a ligand in coordination chemistry. The presence of nitrogen atoms contributes to its basicity and nucleophilicity, making it useful in various chemical reactions. The stereochemistry of (1S)-DBH indicates that it has a specific spatial arrangement, which can influence its reactivity and interactions with other molecules. Additionally, its relatively rigid structure can facilitate the formation of stable complexes with metal ions. The compound is typically handled under standard laboratory conditions, and its properties may vary based on the specific environment and conditions in which it is used. Overall, (1S)-2,5-Diazabicyclo[2.2.1]heptane is an interesting compound with diverse applications in synthetic and medicinal chemistry.
Formula:C5H10N2
InChI:InChI=1/C5H10N2/c1-4-2-6-5(1)3-7-4/h4-7H,1-3H2/t4-,5?/m0/s1
SMILES:C1[C@H]2CNC1CN2
Synonyms:
  • (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane
  • (4S)-3,6-diazabicyclo[2.2.1]heptane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.