CAS 13234-21-4
:5-(prop-1-en-2-yl)bicyclo[2.2.1]hept-2-ene
Description:
5-(Prop-1-en-2-yl)bicyclo[2.2.1]hept-2-ene, with the CAS number 13234-21-4, is an organic compound characterized by its bicyclic structure, which consists of a bicyclo[2.2.1]heptane framework with a prop-1-en-2-yl substituent. This compound features a double bond in the prop-1-en-2-yl group, contributing to its reactivity and potential for undergoing various chemical transformations, such as polymerization or addition reactions. The bicyclic nature of the compound imparts unique steric and electronic properties, making it of interest in synthetic organic chemistry and materials science. Its structural configuration can influence its physical properties, such as boiling point, melting point, and solubility, which are typically determined by the presence of functional groups and the overall molecular geometry. Additionally, the compound may exhibit specific reactivity patterns due to the strained bicyclic system, which can be exploited in synthetic pathways. Overall, 5-(prop-1-en-2-yl)bicyclo[2.2.1]hept-2-ene is a valuable compound for research and industrial applications.
Formula:C10H14
InChI:InChI=1/C10H14/c1-7(2)10-6-8-3-4-9(10)5-8/h3-4,8-10H,1,5-6H2,2H3
SMILES:C=C(C)C1CC2C=CC1C2
Synonyms:- Bicyclo[2.2.1]Hept-2-Ene, 5-(1-Methylethenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
