CAS 13234-79-2
:[1,1'-biphenyl]-2-carboxamide
Description:
[1,1'-Biphenyl]-2-carboxamide, with the CAS number 13234-79-2, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxamide functional group (-C(=O)NH2) at the second position of the biphenyl framework imparts specific chemical properties, including the ability to engage in hydrogen bonding, which can influence its solubility and reactivity. This compound is typically a white to off-white solid and may exhibit moderate stability under standard conditions. Its molecular structure allows for potential applications in various fields, including pharmaceuticals and materials science, due to its ability to interact with biological systems and its potential as a building block for more complex molecules. Additionally, the compound's properties can be influenced by factors such as temperature, solvent interactions, and the presence of other functional groups, making it a subject of interest in synthetic organic chemistry and medicinal chemistry research.
Formula:C13H11NO
InChI:InChI=1S/C13H11NO/c14-13(15)12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9H,(H2,14,15)
InChI key:InChIKey=GTKIGDZXPDCIKR-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=C(C=CC=C1)C2=CC=CC=C2
Synonyms:- 2-Biphenylcarboxamide
- 2-Phenylbenzamide
- Biphenyl-2-Carboxamide
- (1,1'-Biphenyl)-2-carboxamide
- [1,1′-Biphenyl]-2-carboxamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
[1,1'-Biphenyl]-2-carboxamide
CAS:Formula:C13H11NOPurity:97%Color and Shape:SolidMolecular weight:197.23252-Phenylbenzamide
CAS:2-Phenylbenzamide (2PB) is a drug that belongs to the class of anthelmintics. It binds to the nicotinic acetylcholine receptor and inhibits the release of acetylcholine at neuromuscular junctions, leading to paralysis and death of the parasite. 2PB also has been shown to have anti-inflammatory properties in mice with colitis, which may be due to its ability to inhibit prostaglandin synthesis. The molecular docking analysis showed that 2PB binds covalently with nitro-containing molecules, such as nitrosamines, which are found in cigarette smoke and are known carcinogens. This binding may contribute to the development of cancer through inhibition of DNA repair mechanisms.
Formula:C13H11NOPurity:Min. 95%Color and Shape:PowderMolecular weight:197.23 g/mol



