CAS 132342-55-3
:Methyl (2R,4aR)-1,2,3,4,4a,5,6,7-octahydro-4a,8-dimethyl-α-methylene-2-naphthaleneacetate
Description:
Methyl (2R,4aR)-1,2,3,4,4a,5,6,7-octahydro-4a,8-dimethyl-α-methylene-2-naphthaleneacetate, identified by its CAS number 132342-55-3, is a complex organic compound characterized by its bicyclic structure, which includes a naphthalene moiety. This compound features multiple chiral centers, contributing to its stereochemical complexity. It is typically classified as an ester due to the presence of the acetate functional group. The presence of the α-methylene group suggests potential reactivity, particularly in addition reactions. The octahydro structure indicates that it is a saturated compound, which may exhibit interesting physical properties such as solubility and boiling point, influenced by its molecular weight and functional groups. This compound may be of interest in various fields, including organic synthesis and medicinal chemistry, due to its potential biological activity and structural characteristics. However, specific applications and biological effects would require further investigation and research.
Formula:C16H24O2
InChI:InChI=1S/C16H24O2/c1-11-6-5-8-16(3)9-7-13(10-14(11)16)12(2)15(17)18-4/h13H,2,5-10H2,1,3-4H3/t13-,16-/m1/s1
InChI key:InChIKey=OWZSHJKGKHTKDS-CZUORRHYSA-N
SMILES:C[C@]12C(C[C@H](C(C(OC)=O)=C)CC1)=C(C)CCC2
Synonyms:- 2-Naphthaleneacetic acid, 1,2,3,4,4a,5,6,7-octahydro-4a,8-dimethyl-α-methylene-, methyl ester, (2R-cis)-
- Methyl (2R,4aR)-1,2,3,4,4a,5,6,7-octahydro-4a,8-dimethyl-α-methylene-2-naphthaleneacetate
- Methyl isocostate
- Isocostic acid methyl ester
- 2-Naphthaleneacetic acid, 1,2,3,4,4a,5,6,7-octahydro-4a,8-dimethyl-α-methylene-, methyl ester, (2R,4aR)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Methyl isocostate
CAS:Methyl isocostate is a natural product for research related to life sciences. The catalog number is TN4546 and the CAS number is 132342-55-3.Formula:C16H24O2Purity:98%Color and Shape:SolidMolecular weight:248.36Methyl isocostate
CAS:Methyl isocostate is a chemical compound that is a synthetic ester, which is derived from the esterification of the corresponding hydroxyl acid. Its origin lies in the intricate processes of synthetic organic chemistry, where it serves as an intermediate or precursor in various reactions. Methyl isocostate operates through its functional ester group, which participates in nucleophilic substitution and other ester-related chemical transformations.Formula:C16H24O2Purity:Min. 95%Molecular weight:248.36 g/mol


