
CAS 13236-84-5
:N-(4,6-Diamino-1,3,5-triazin-2-yl)formamide
Description:
N-(4,6-Diamino-1,3,5-triazin-2-yl)formamide, with the CAS number 13236-84-5, is a chemical compound characterized by its triazine ring structure, which is a six-membered heterocycle containing three nitrogen atoms. This compound features amino groups that contribute to its reactivity and potential applications in various fields, including agriculture and pharmaceuticals. It is soluble in polar solvents, which enhances its utility in formulations. The presence of the formamide functional group indicates that it can participate in hydrogen bonding, influencing its interactions with other molecules. This compound is often studied for its biological activity, particularly in relation to its potential as a herbicide or in other agrochemical applications. Its stability and reactivity can be affected by environmental conditions, making it important to consider these factors in practical applications. Overall, N-(4,6-Diamino-1,3,5-triazin-2-yl)formamide is notable for its unique structural features and potential utility in various chemical processes.
Formula:C4H6N6O
InChI:InChI=1S/C4H6N6O/c5-2-8-3(6)10-4(9-2)7-1-11/h1H,(H5,5,6,7,8,9,10,11)
InChI key:InChIKey=BPISYIZLDVUTAP-UHFFFAOYSA-N
SMILES:N(C=O)C=1N=C(N)N=C(N)N1
Synonyms:- Formamide, N-(4,6-diamino-s-triazin-2-yl)-
- N-(4,6-Diamino-1,3,5-triazin-2-yl)formamide
- Formamide, N-(4,6-diamino-1,3,5-triazin-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
