CymitQuimica logo

CAS 132360-05-5

:

6-(4-Fluorophenyl)-1,2-dihydro-4-methyl-2-thioxo-3-pyridinecarbonitrile

Description:
6-(4-Fluorophenyl)-1,2-dihydro-4-methyl-2-thioxo-3-pyridinecarbonitrile, with the CAS number 132360-05-5, is a chemical compound that belongs to the class of pyridine derivatives. This substance features a pyridine ring substituted with a thioxo group and a cyano group, contributing to its potential reactivity and biological activity. The presence of the 4-fluorophenyl group enhances its lipophilicity and may influence its interaction with biological targets. The compound is characterized by its unique structural features, including a dihydro configuration, which can affect its stereochemistry and reactivity. It may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Additionally, the thioxo group can participate in various chemical reactions, potentially leading to the formation of diverse derivatives. As with many organic compounds, its solubility, stability, and reactivity can be influenced by environmental conditions such as pH and temperature. Overall, this compound's unique structure suggests potential applications in drug development and other chemical research areas.
Formula:C13H9FN2S
InChI:InChI=1S/C13H9FN2S/c1-8-6-12(16-13(17)11(8)7-15)9-2-4-10(14)5-3-9/h2-6H,1H3,(H,16,17)
InChI key:InChIKey=NDMAOKQTCODWGU-UHFFFAOYSA-N
SMILES:CC=1C=C(NC(=S)C1C#N)C2=CC=C(F)C=C2
Synonyms:
  • 6-(4-Fluorophenyl)-1,2-dihydro-4-methyl-2-thioxo-3-pyridinecarbonitrile
  • 3-Pyridinecarbonitrile, 6-(4-fluorophenyl)-1,2-dihydro-4-methyl-2-thioxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.