CAS 132367-80-7
:N-Bromobenzenesulfonamide
Description:
N-Bromobenzenesulfonamide is an organic compound characterized by the presence of a bromine atom attached to a benzenesulfonamide group. It typically appears as a white to off-white solid and is known for its role as a reagent in various chemical reactions, particularly in the field of organic synthesis. The sulfonamide functional group contributes to its solubility in polar solvents, while the bromine atom enhances its reactivity, making it useful in electrophilic substitution reactions. This compound is often utilized in the synthesis of pharmaceuticals and agrochemicals, as well as in the development of dyes and other organic materials. Safety considerations are important when handling N-bromobenzenesulfonamide, as it may pose health risks if inhaled or ingested, and appropriate protective measures should be taken. Its stability under standard conditions allows for its use in various laboratory applications, although it should be stored properly to prevent degradation.
Formula:C6H6BrNO2S
InChI:InChI=1S/C6H6BrNO2S/c7-8-11(9,10)6-4-2-1-3-5-6/h1-5,8H
InChI key:InChIKey=CIZZBNHBFCGHME-UHFFFAOYSA-N
SMILES:S(NBr)(=O)(=O)C1=CC=CC=C1
Synonyms:- N-Bromobenzenesulfonamide
- Benzenesulfonamide, N-bromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
