CAS 13238-38-5

3-PHENYLETHYNYL-PYRIDINE

Description:

3-Phenylethynyl-pyridine, with the CAS number 13238-38-5, is an organic compound characterized by its pyridine ring substituted with a phenylethynyl group. This compound typically exhibits a pale yellow to brownish appearance and is known for its aromatic properties due to the presence of both the phenyl and pyridine moieties. It is generally soluble in organic solvents, such as ethanol and dichloromethane, but may have limited solubility in water. The compound is of interest in various fields, including organic synthesis and materials science, due to its potential applications in the development of pharmaceuticals and as a ligand in coordination chemistry. Its chemical structure allows for various reactions, including electrophilic substitutions and coupling reactions, making it a versatile building block in synthetic organic chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₃H₉N

InChI: InChI=1/C13H9N/c1-2-5-12(6-3-1)8-9-13-7-4-10-14-11-13/h1-7,10-11H

SMILES: c1ccc(cc1)C#Cc1cccnc1

Synonyms:

• Pyridine, 3-(2-Phenylethynyl)-
• 3-(Phenylethynyl)pyridine

3-Phenylethynyl-pyridine

CAS: 13238-38-5

Formula: C₁₃H₉N

Purity: 95%

Color and Shape: Solid

Molecular weight: 179.2173

Ref: IN-DA0010MB

3-(2-phenylethynyl)pyridine

CAS: 13238-38-5

3-(2-phenylethynyl)pyridine

Purity: ≥95%

Molecular weight: 179.22g/mol

Ref: 54-BUP08422

3-(Phenylethynyl)pyridine

CAS: 13238-38-5

3-(Phenylethynyl)pyridine

Purity: ≥95%

Molecular weight: 179.22g/mol

Ref: 54-OR315659

3-(2-phenylethynyl)pyridine

CAS: 13238-38-5

3-(2-Phenylethynyl)pyridine: ligand for D2, sigma-1, 5-HT6 receptors; potential in treating schizophrenia, depression, and Alzheimer's.

Formula: C₁₃H₉N

Purity: 99.09%

Color and Shape: Solid

Molecular weight: 179.22

Ref: TM-T50090

3-(pHenylethynyl)pyridine

CAS: 13238-38-5

Purity: 95%

Molecular weight: 179.2220001

Ref: 10-F661024