CAS 132392-26-8
:5,5,8,8-Tetramethyl-5,6,7,8-tetrahydro-2- naphthalenesulfonyl chloride
Description:
5,5,8,8-Tetramethyl-5,6,7,8-tetrahydro-2-naphthalenesulfonyl chloride is a chemical compound characterized by its complex structure, which includes a naphthalene moiety and a sulfonyl chloride functional group. This compound is typically a white to off-white solid and is known for its reactivity due to the presence of the sulfonyl chloride group, which can participate in nucleophilic substitution reactions. It is often used as a reagent in organic synthesis, particularly in the preparation of sulfonamides and other derivatives. The presence of multiple methyl groups contributes to its steric hindrance, which can influence its reactivity and solubility in various solvents. Additionally, the compound's stability can be affected by moisture, as sulfonyl chlorides are generally sensitive to hydrolysis. Proper handling and storage conditions are essential to maintain its integrity and effectiveness in chemical reactions. Safety precautions should be observed due to its potential irritant properties and reactivity with water.
Formula:C14H19ClO2S
InChI:InChI=1/C14H19ClO2S/c1-13(2)7-8-14(3,4)12-9-10(18(15,16)17)5-6-11(12)13/h5-6,9H,7-8H2,1-4H3
SMILES:CC1(C)CCC(C)(C)c2cc(ccc12)S(=O)(=O)Cl
Synonyms:- 5,5,8,8-Tetramethyl-5,6,7,8-Tetrahydronaphthalene-2-Sulfonyl Chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5,5,8,8-Tetramethyl-5,6,7,8-tetrahydronaphthalene-2-sulfonyl chloride
CAS:Formula:C14H19ClO2SColor and Shape:SolidMolecular weight:286.8175
