CAS 1323966-38-6
:4-Fluoro-2-(trifluoromethoxy)benzoyl chloride
Description:
4-Fluoro-2-(trifluoromethoxy)benzoyl chloride is an organic compound characterized by its functional groups, which include a benzoyl chloride moiety and a trifluoromethoxy substituent. The presence of the fluorine atoms contributes to its unique chemical properties, such as increased lipophilicity and potential reactivity in nucleophilic substitution reactions. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its application in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, where it can serve as an acylating agent. The trifluoromethoxy group enhances the compound's stability and influences its electronic properties, making it a valuable intermediate in various chemical reactions. Due to its reactive nature, particularly as a chlorinated compound, it must be handled with care, adhering to safety protocols to avoid exposure to its potentially hazardous effects. Overall, 4-Fluoro-2-(trifluoromethoxy)benzoyl chloride is a significant compound in synthetic organic chemistry.
Formula:C8H3ClF4O2
InChI:InChI=1S/C8H3ClF4O2/c9-7(14)5-2-1-4(10)3-6(5)15-8(11,12)13/h1-3H
InChI key:InChIKey=RAPKOVZLHNOHEJ-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C1=C(OC(F)(F)F)C=C(F)C=C1
Synonyms:- Benzoyl chloride, 4-fluoro-2-(trifluoromethoxy)-
- 4-Fluoro-2-(trifluoromethoxy)benzoyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Fluoro-2-(trifluoromethoxy)benzoyl chloride
CAS:4-Fluoro-2-(trifluoromethoxy)benzoyl chloride
Color and Shape:LiquidMolecular weight:242.55g/mol
