CAS 13241-00-4
:(2S,3S,4S)-6-(hydroxymethyl)-2-methoxy-tetrahydropyran-3,4-diol
Description:
The chemical substance known as "(2S,3S,4S)-6-(hydroxymethyl)-2-methoxy-tetrahydropyran-3,4-diol," with the CAS number 13241-00-4, is a carbohydrate derivative characterized by its tetrahydropyran ring structure. This compound features multiple hydroxyl groups, which contribute to its hydrophilicity and potential for forming hydrogen bonds, making it soluble in water. The presence of a methoxy group enhances its chemical reactivity and influences its physical properties. The stereochemistry indicated by the (2S,3S,4S) configuration suggests specific spatial arrangements of its substituents, which can significantly affect its biological activity and interactions with other molecules. This compound may be of interest in various fields, including medicinal chemistry and biochemistry, due to its potential applications in drug development or as a biochemical probe. Its structural characteristics also suggest potential roles in glycosylation reactions or as a building block for more complex organic synthesis. Overall, the unique features of this compound make it a subject of interest for further research and application in chemical and pharmaceutical sciences.
Formula:C7H14O5
InChI:InChI=1/C7H14O5/c1-11-7-6(10)5(9)2-4(3-8)12-7/h4-10H,2-3H2,1H3/t4?,5-,6-,7-/m0/s1
SMILES:CO[C@@H]1[C@H]([C@H](CC(CO)O1)O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Methyl 4-deoxy-a-D-glucopyranoside
CAS:Methyl 4-deoxy-a-D-glucopyranoside is a high purity synthetic sugar with the molecular formula C5H10O5. It has been custom synthesized for Click modification, fluorination, glycosylation and methylation. Methyl 4-deoxy-a-D-glucopyranoside is used in glycosylation as a monosaccharide or saccharide to form complex carbohydrates. This product can be used in the synthesis of oligosaccharides and polysaccharides.Formula:C7H14O5Purity:Min. 95%Molecular weight:178.19 g/mol


