CAS 13241-36-6
:1,4:3,6-Dianhydro-D-threo-2,5-hexodiulose
Description:
1,4:3,6-Dianhydro-D-threo-2,5-hexodiulose, with the CAS number 13241-36-6, is a carbohydrate derivative characterized by its unique anhydro structure, which results from the dehydration of specific hydroxyl groups. This compound features a six-carbon sugar backbone, specifically a hexodiulose, which is a type of sugar that contains both aldehyde and ketone functional groups. The "dianhydro" designation indicates that two water molecules have been removed from the sugar, leading to a cyclic structure that enhances its stability and reactivity. This compound is of interest in various fields, including organic chemistry and biochemistry, due to its potential applications in synthesizing other complex carbohydrates and as a building block in glycosylation reactions. Its stereochemistry, denoted by the "D-threo" configuration, suggests specific spatial arrangements of its hydroxyl groups, which can influence its biological activity and interactions with enzymes. Overall, 1,4:3,6-Dianhydro-D-threo-2,5-hexodiulose is a significant compound in the study of sugar chemistry and its derivatives.
Formula:C6H6O4
InChI:InChI=1S/C6H6O4/c7-3-1-9-6-4(8)2-10-5(3)6/h5-6H,1-2H2/t5-,6-/m1/s1
InChI key:InChIKey=WDUVHBUZEIBPBR-PHDIDXHHSA-N
SMILES:O=C1[C@@]2([C@@](C(=O)CO2)(OC1)[H])[H]
Synonyms:- 1,4:3,6-Dianhydro-D-threo-2,5-hexodiulose
- D-threo-2,5-Hexodiulose, 1,4:3,6-dianhydro-
- Furo[3,2-b]furan, D-threo-2,5-hexodiulose deriv.
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
