CAS 132413-50-4
:2,3,4,6-tetra-O-benzoyl-beta-D-glucopy-ranosyl isothiocyan.
Description:
2,3,4,6-Tetra-O-benzoyl-beta-D-glucopyranosyl isothiocyanate is a glycosyl isothiocyanate derivative, characterized by the presence of a glucopyranosyl moiety with four benzoyl protecting groups. This compound features a beta configuration at the anomeric carbon, which influences its reactivity and solubility. The isothiocyanate functional group is known for its biological activity, including potential anticancer properties and its role in the synthesis of various bioactive compounds. The presence of multiple benzoyl groups enhances the lipophilicity of the molecule, which can affect its interaction with biological membranes and its overall pharmacokinetics. This compound is typically used in organic synthesis and may serve as an intermediate in the preparation of more complex molecules. Its stability and reactivity can be influenced by the conditions under which it is handled, including temperature and the presence of nucleophiles. Overall, 2,3,4,6-tetra-O-benzoyl-beta-D-glucopyranosyl isothiocyanate is a significant compound in the field of medicinal chemistry and glycoscience.
Formula:C35H27NO9S
InChI:InChI=1/C35H27NO9S/c37-32(23-13-5-1-6-14-23)41-21-27-28(43-33(38)24-15-7-2-8-16-24)29(44-34(39)25-17-9-3-10-18-25)30(31(42-27)36-22-46)45-35(40)26-19-11-4-12-20-26/h1-20,27-31H,21H2/t27-,28-,29+,30-,31-/m1/s1
Synonyms:- 2,3,4,6-Tetra-O-benzoyl--D-glucopyranosyl isothiocyanate
- 2,3,4,6-tetra-O-benzoyl-N-(thioxomethylidene)-beta-D-glucopyranosylamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
β-D-Glucopyranosyl isothiocyanate, 2,3,4,6-tetrabenzoate
CAS:Formula:C35H27NO9SPurity:98%Color and Shape:SolidMolecular weight:637.65522,3,4,6-Tetra-O-benzoyl-b-D-glucopyranosyl isothiocyanate
CAS:2,3,4,6-Tetra-O-benzoyl-b-D-glucopyranosyl isothiocyanate (TBG) is a fluorescent compound that has been shown to inhibit the activity of proteinase and other enzymes. TBG is also an inhibitor of human blood glucose levels. This compound is not chiral, but it can be used as a reagent for the production of chiral compounds. TBG binds to DNA with high affinity and specificity. It has been shown to act as a growth factor for some cancer cells by inhibiting the expression of p21 protein.
Formula:C35H27NO9SPurity:Min. 95%Molecular weight:637.66 g/molRef: 3D-MT05028
Discontinued product


