CymitQuimica logo

CAS 132414-56-3

:

Decahydropyrrolo[3,4-b]pyrrolizin-6-ol

Description:
Decahydropyrrolo[3,4-b]pyrrolizin-6-ol is a bicyclic organic compound characterized by its complex ring structure, which includes a pyrrolidine and a pyrrolizin moiety. This compound features a saturated framework, contributing to its stability and unique chemical properties. The presence of a hydroxyl group (-OH) at the 6-position enhances its reactivity, making it a potential candidate for various chemical transformations. Its molecular structure suggests it may exhibit interesting biological activities, which could be explored in medicinal chemistry. The compound is likely to be soluble in polar solvents due to the hydroxyl group, while its bicyclic nature may influence its interaction with biological targets. As with many organic compounds, its physical properties, such as melting point and boiling point, would depend on the specific conditions and purity of the sample. Overall, Decahydropyrrolo[3,4-b]pyrrolizin-6-ol represents a fascinating subject for further research in both synthetic and medicinal chemistry contexts.
Formula:C9H16N2O
InChI:InChI=1S/C9H16N2O/c12-8-2-7-1-6-3-10-4-9(6)11(7)5-8/h6-10,12H,1-5H2
InChI key:InChIKey=SJDZPADKNDLZRG-UHFFFAOYSA-N
SMILES:OC1CN2C3C(CC2C1)CNC3
Synonyms:
  • Pyrrolo[3,4-b]pyrrolizin-6-ol, decahydro-
  • Decahydropyrrolo[3,4-b]pyrrolizin-6-ol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.