CymitQuimica logo

CAS 132414-79-0

:

Ethyl hexahydropyrrolo[3,4-b]pyrrole-5(1H)-carboxylate

Description:
Ethyl hexahydropyrrolo[3,4-b]pyrrole-5(1H)-carboxylate is a chemical compound characterized by its complex bicyclic structure, which includes a pyrrole ring fused to a hexahydropyrrole moiety. This compound typically exhibits properties associated with nitrogen-containing heterocycles, such as moderate polarity and potential solubility in organic solvents. Its carboxylate functional group suggests it may participate in various chemical reactions, including esterification and nucleophilic substitutions. Ethyl hexahydropyrrolo[3,4-b]pyrrole-5(1H)-carboxylate may also display biological activity, making it of interest in pharmaceutical research. The presence of multiple rings and functional groups can influence its reactivity, stability, and interaction with biological systems. Additionally, the compound's molecular weight and specific stereochemistry can affect its physical properties, such as melting point and boiling point, although these specific values would need to be referenced from experimental data or literature. Overall, this compound represents a unique structure within the realm of organic chemistry, with potential applications in various fields.
Formula:C9H16N2O2
InChI:InChI=1S/C9H16N2O2/c1-2-13-9(12)11-5-7-3-4-10-8(7)6-11/h7-8,10H,2-6H2,1H3
InChI key:InChIKey=SULDDMOQJXWUNO-UHFFFAOYSA-N
SMILES:C(OCC)(=O)N1CC2C(C1)NCC2
Synonyms:
  • Ethyl hexahydropyrrolo[3,4-b]pyrrole-5(1H)-carboxylate
  • Hexahydropyrrolo[3,4-b]pyrrole-5(1H)-carboxylic acid ethyl ester
  • Pyrrolo[3,4-b]pyrrole-5(1H)-carboxylic acid, hexahydro-, ethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.