CAS 132431-09-5

(Cbz-4-aminomethyl)piperidine

Description:

(Cbz-4-aminomethyl)piperidine, with the CAS number 132431-09-5, is a chemical compound characterized by its piperidine core, which is a six-membered saturated nitrogen-containing heterocycle. The compound features a carbobenzyloxy (Cbz) protecting group attached to the amino group at the 4-position of the piperidine ring, along with an aminomethyl substituent. This structure imparts specific reactivity and solubility characteristics, making it useful in organic synthesis, particularly in the development of pharmaceuticals and other bioactive compounds. The presence of the Cbz group allows for selective deprotection under mild conditions, facilitating further functionalization of the piperidine moiety. Additionally, the compound's basicity is influenced by the nitrogen atom in the piperidine ring, which can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Overall, (Cbz-4-aminomethyl)piperidine serves as a versatile intermediate in synthetic organic chemistry, with applications in medicinal chemistry and the development of complex molecular architectures.

Formula: C₁₄H₂₀N₂O₂

InChI: InChI=1/C14H20N2O2/c17-14(16-10-12-6-8-15-9-7-12)18-11-13-4-2-1-3-5-13/h1-5,12,15H,6-11H2,(H,16,17)

SMILES: c1ccc(cc1)COC(=NCC1CCNCC1)O

Synonyms:

• Benzyl (Piperidin-4-Ylmethyl)Carbamate
• Carbamic acid,N-(4-piperidinylmethyl)-, phenylmethyl ester
• Piperidin-4-Ylmethyl-Carbamic Acid Benzyl Ester

Benzyl (piperidin-4-ylmethyl)carbamate

CAS: 132431-09-5

Formula: C₁₄H₂₀N₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 248.3208

Ref: IN-DA00808F

(Cbz-4-aminomethyl)piperidine

CAS: 132431-09-5

(Cbz-4-aminomethyl)piperidine

Purity: 95%

Molecular weight: 248.32g/mol

Ref: 54-OR1008312

(Cbz-4-Aminomethyl)piperidine

CAS: 132431-09-5

Formula: C₁₄H₂₀N₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 248.326

Ref: 10-F048993