CAS 13244-33-2
:2-Amino-5-methoxybenzenesulfonic acid
Description:
2-Amino-5-methoxybenzenesulfonic acid, also known as 5-Methoxy-2-aminobenzenesulfonic acid, is an organic compound characterized by the presence of an amino group (-NH2), a methoxy group (-OCH3), and a sulfonic acid group (-SO3H) attached to a benzene ring. This compound is typically a white to off-white solid and is soluble in water due to the sulfonic acid functionality, which enhances its polarity. It exhibits properties typical of sulfonic acids, such as being a strong acid in aqueous solutions. The amino group can participate in various chemical reactions, making it a useful intermediate in organic synthesis, particularly in the production of dyes, pharmaceuticals, and agrochemicals. Additionally, the methoxy group can influence the compound's reactivity and solubility. Safety data indicates that, like many sulfonic acids, it should be handled with care, as it may cause irritation to skin and eyes. Overall, 2-Amino-5-methoxybenzenesulfonic acid is a versatile compound with applications in various chemical industries.
Formula:C7H9NO4S
InChI:InChI=1S/C7H9NO4S/c1-12-5-2-3-6(8)7(4-5)13(9,10)11/h2-4H,8H2,1H3,(H,9,10,11)
InChI key:InChIKey=KZKGEEGADAWJFS-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)C1=CC(OC)=CC=C1N
Synonyms:- 1-Amino-4-methoxybenzene-2-sulfonic acid
- 2-Amino-5-Methoxybenzenesulfonate
- 2-Amino-5-Methoxybenzenesulfonic Acid
- 2-Amino-5-methoxybenzene-1-sulfonic acid
- 4-Amino-3-sulfoanisole
- 4-Anisidine-2-sulfonic acid
- 4-Methoxy-1-aminobenzene-2-sulfonic acid
- 4-Methoxy-2-sulfoaniline
- 4-Methoxyaniline-2-sulfonic acid
- 5-Amino-2-Methoxybenzenesulfonic Acid
- 6-Amino-3-methoxybenzenesulfonic acid
- Benzenesulfonic acid, 2-amino-5-methoxy-
- P-Anisidine-M-Sulfonic Acid
- p-Anisidine-3-sulfonic Acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
p-Anisidine-2-sulfonic Acid
CAS:Formula:C7H9NO4SPurity:>97.0%(T)(HPLC)Color and Shape:White to Gray to Brown powder to crystalMolecular weight:203.212-Amino-5-methoxybenzenesulfonic acid
CAS:Formula:C7H9NO4SPurity:98%Color and Shape:SolidMolecular weight:203.21572-Amino-5-methoxybenzenesulfonic acid
CAS:2-Amino-5-methoxybenzenesulfonic acidPurity:98%Color and Shape:SolidMolecular weight:203.22g/mol2-Amino-5-methoxybenzenesulfonic acid
CAS:Formula:C7H9NO4SPurity:98%Color and Shape:SolidMolecular weight:203.214-Aminoanisole-3-sulfonic acid
CAS:4-Aminoanisole-3-sulfonic acid is a nitro compound that is used as a buffer and pH stabilizer. It is synthesized by the reaction of methoxyaniline with sulfonic acids. 4-Aminoanisole-3-sulfonic acid has been shown to react with x-rays, forming an optical sensor. This chemical can also be used to synthesize other sulfonated compounds such as sulfonates and sulfites. This compound can be prepared by the addition of hydrochloric acid to zinc powder followed by the addition of hydrogen sulfate, which gives the final product in a chlorinated form.Formula:C7H9NO4SPurity:Min. 95%Molecular weight:203.22 g/mol





