CAS 132442-43-4
:4-(4-FLUOROBENZOYL)PIPERIDINE P-TOLUENESULFONATE
Description:
4-(4-Fluorobenzoyl)piperidine p-toluenesulfonate is a chemical compound characterized by its complex structure, which includes a piperidine ring substituted with a 4-fluorobenzoyl group and a p-toluenesulfonate moiety. This compound typically appears as a solid and is soluble in organic solvents, reflecting its polar and non-polar characteristics due to the presence of both aromatic and aliphatic components. The fluorobenzoyl group contributes to its potential as a pharmacophore, possibly influencing its biological activity and interactions with various targets. The p-toluenesulfonate part of the molecule can enhance solubility and stability, making it useful in various chemical applications, including medicinal chemistry and drug formulation. Its CAS number, 132442-43-4, allows for precise identification in chemical databases. As with many organic compounds, safety data should be consulted to understand its handling, storage, and potential hazards. Overall, this compound exemplifies the intricate design often found in pharmaceutical chemistry, where specific functional groups are tailored for desired properties.
Formula:C12H15FNO
InChI:InChI=1/C12H14FNO/c13-11-3-1-9(2-4-11)12(15)10-5-7-14-8-6-10/h1-4,10,14H,5-8H2/p+1
Synonyms:- 4-(4-Fluorobenzoyl)piperidine p-toluenesulfonate, contains HCl-salt, 95%
- 4-(4-Fluorobenzoyl)piperidinium tosylate.
- 4-(4-Fluorobenzoyl)piperidine p-toluenesulfonate, 95%, contains HCl-salt
- 4-[(4-Fluorophenyl)Carbonyl]Piperidinium 4-Methylbenzenesulfonate
- 4-[(4-Fluorophenyl)Carbonyl]Piperidinium
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
