CAS 13246-14-5

2′,6′-Dimethoxy-4′-hydroxyacetophenone

Description:

2′,6′-Dimethoxy-4′-hydroxyacetophenone, with the CAS number 13246-14-5, is an organic compound characterized by its aromatic structure, which includes a phenolic hydroxyl group and two methoxy groups attached to the aromatic ring. This compound typically exhibits a white to off-white crystalline appearance. It is soluble in organic solvents such as ethanol and methanol but has limited solubility in water due to its hydrophobic aromatic nature. The presence of the hydroxyl group contributes to its potential as an antioxidant and may influence its reactivity in various chemical reactions. Additionally, the methoxy groups can affect the compound's electronic properties, making it a subject of interest in fields such as medicinal chemistry and materials science. Its derivatives and analogs may exhibit biological activities, including antimicrobial and anti-inflammatory properties, which are often explored in pharmacological studies. Overall, 2′,6′-Dimethoxy-4′-hydroxyacetophenone is a versatile compound with potential applications in various chemical and pharmaceutical contexts.

Formula: C₁₀H₁₂O₄

InChI: InChI=1S/C10H12O4/c1-6(11)10-8(13-2)4-7(12)5-9(10)14-3/h4-5,12H,1-3H3

InChI key: InChIKey=AZRTXUQINTVMDW-UHFFFAOYSA-N

SMILES: C(C)(=O)C1=C(OC)C=C(O)C=C1OC

Synonyms:

• 2,6-Dimethoxy-4-hydroxyacetophenone
• 2′,6′-Dimethoxy-4′-hydroxyacetophenone
• Ethanone, 1-(4-hydroxy-2,6-dimethoxyphenyl)-
• 1-(4-Hydroxy-2,6-dimethoxyphenyl)ethanone
• Acetophenone, 4′-hydroxy-2′,6′-dimethoxy-