CAS 132461-40-6

3,4-Dimethyl-2-nitro-3H-imidazo[4,5-F]quinoline

Description:

3,4-Dimethyl-2-nitro-3H-imidazo[4,5-F]quinoline is a heterocyclic organic compound characterized by its fused ring structure, which incorporates both imidazole and quinoline moieties. This compound features two methyl groups at the 3 and 4 positions and a nitro group at the 2 position, contributing to its unique chemical properties. It is typically a yellow to orange solid, exhibiting moderate solubility in organic solvents. The presence of the nitro group introduces polar characteristics, which can influence its reactivity and interactions with biological systems. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its structural features suggest potential applications in the development of pharmaceuticals, particularly in targeting specific biological pathways. Additionally, the compound's stability and reactivity can be influenced by the presence of the nitro and methyl substituents, which may affect its synthesis and functionalization in various chemical reactions. Overall, 3,4-Dimethyl-2-nitro-3H-imidazo[4,5-F]quinoline represents a complex and potentially valuable chemical entity in research and development.

Formula: C₁₂H₁₀N₄O₂

InChI: InChI=1/C12H10N4O2/c1-7-6-9-8(4-3-5-13-9)10-11(7)15(2)12(14-10)16(17)18/h3-6H,1-2H3

SMILES: Cc1cc2c(cccn2)c2c1n(C)c(n2)N(=O)=O

Synonyms:

• 3,4-Dimethyl-2-Nitroimidazo-(4,5-F)Quinoline

3,4-Dimethyl-2-nitro-3H-imidazo[4,5-f]quinoline

CAS: 132461-40-6

Formula: C₁₂H₁₀N₄O₂

Color and Shape: Solid

Molecular weight: 242.2334

Ref: IN-DA0010PA

3,4-Dimethyl-2-nitro-3H-imidazo[4,5-f]quinoline

Controlled Product

CAS: 132461-40-6

Applications An adduct of MeIQ-nucleotide. It is the nitro derivative of MeIQ, one of the food pyrolysis product mutagens and carcinogens.
References Kosakarn, P., et al.: Carcinogenesis, 14, 511 (1993),

Formula: C₁₂H₁₀N₄O₂

Color and Shape: Neat

Molecular weight: 242.23

Ref: TR-D475000