CymitQuimica logo

CAS 132461-41-7

:

(4Z)-6-[(1R,2R,5R)-2-(biphenyl-4-ylmethoxy)-5-piperidin-1-ylcyclopentyl]hex-4-enoic acid

Description:
The chemical substance known as (4Z)-6-[(1R,2R,5R)-2-(biphenyl-4-ylmethoxy)-5-piperidin-1-ylcyclopentyl]hex-4-enoic acid, with the CAS number 132461-41-7, is a complex organic compound characterized by its unique structural features. It contains a hexenoic acid backbone with a double bond at the 4-position, indicating its unsaturated nature. The presence of a piperidine ring and a biphenyl moiety suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The stereochemistry, denoted by the (1R,2R,5R) configuration, indicates specific spatial arrangements that can influence the compound's biological activity and pharmacokinetics. This compound may exhibit properties such as lipophilicity due to the biphenyl group, which can affect its solubility and permeability in biological systems. Additionally, the cyclopentyl and piperidinyl substituents may contribute to its binding affinity to various receptors or enzymes. Overall, this compound's intricate structure suggests potential applications in drug development, particularly in areas targeting neurological or psychiatric conditions.
Formula:C29H37NO3
InChI:InChI=1/C29H37NO3/c31-29(32)13-7-2-6-12-26-27(30-20-8-3-9-21-30)18-19-28(26)33-22-23-14-16-25(17-15-23)24-10-4-1-5-11-24/h1-2,4-6,10-11,14-17,26-28H,3,7-9,12-13,18-22H2,(H,31,32)/b6-2-/t26-,27-,28-/m1/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.