CymitQuimica logo

CAS 132470-83-8

:

4-Trifluoromethyl-pyridine-2-carbaldehyde

Description:
4-Trifluoromethyl-pyridine-2-carbaldehyde is an organic compound characterized by its pyridine ring substituted with a trifluoromethyl group and an aldehyde functional group. The presence of the trifluoromethyl group significantly influences its chemical properties, enhancing its lipophilicity and reactivity. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its role in various synthetic applications, particularly in the pharmaceutical and agrochemical industries, where it serves as an intermediate in the synthesis of biologically active molecules. The aldehyde functional group makes it susceptible to nucleophilic attack, allowing for further chemical transformations. Additionally, 4-Trifluoromethyl-pyridine-2-carbaldehyde exhibits distinct spectral characteristics in techniques such as NMR and IR spectroscopy, which can be utilized for its identification and analysis. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested, and proper storage conditions are necessary to maintain its stability.
Formula:C7H4F3NO
InChI:InChI=1/C7H4F3NO/c8-7(9,10)5-1-2-11-6(3-5)4-12/h1-4H
InChI key:FKNSTSIMTSEJOD-UHFFFAOYSA-N
SMILES:c1cnc(cc1C(F)(F)F)C=O
Found 4 products.