CAS 132482-43-0

6-Nitrobenzo[a]pyren-1-amine

Description:

6-Nitrobenzo[a]pyren-1-amine is an organic compound that belongs to the class of polycyclic aromatic hydrocarbons (PAHs) and is characterized by the presence of a nitro group and an amine functional group. This compound features a complex fused ring structure, which contributes to its chemical stability and potential for various interactions. It is typically a solid at room temperature and may exhibit a range of physical properties such as solubility in organic solvents. The nitro group introduces electrophilic characteristics, making it reactive under certain conditions, while the amine group can participate in hydrogen bonding and nucleophilic reactions. Due to its structural features, 6-Nitrobenzo[a]pyren-1-amine is of interest in environmental chemistry and toxicology, as many PAHs are known for their carcinogenic properties. Its synthesis and study are relevant in understanding the behavior of nitro-substituted PAHs in biological systems and their potential impact on human health and the environment. Safety precautions are essential when handling this compound due to its potential toxicity.

Formula: C₂₀H₁₂N₂O₂

InChI: InChI=1S/C20H12N2O2/c21-17-10-6-11-5-7-16-19-13(8-9-15(17)18(11)19)12-3-1-2-4-14(12)20(16)22(23)24/h1-10H,21H2

InChI key: InChIKey=RPGRSCMHUVPJSO-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C2C3=C4C(=CC=C3C=5C1=CC=CC5)C(N)=CC=C4C=C2

Synonyms:

• 6-Nitrobenzo[a]pyren-1-amine
• Benzo[a]pyren-1-amine, 6-nitro-

Benzo[a]pyren-1-amine, 6-nitro-

CAS: 132482-43-0

Formula: C₂₀H₁₂N₂O₂

Molecular weight: 312.3215

Ref: IN-DA0010QP