CAS 132487-93-5
:1,4-Naphthalenedione, 2-methyl-3-(3,7,11,15-tetramethyl-2-hexadecenyl)-, [R-[R*,S*-(E)]]-
Description:
1,4-Naphthalenedione, 2-methyl-3-(3,7,11,15-tetramethyl-2-hexadecenyl)-, with the CAS number 132487-93-5, is a complex organic compound characterized by its naphthalene backbone, which is a fused bicyclic aromatic hydrocarbon. The presence of the 1,4-dione functional groups indicates that it contains two carbonyl (C=O) groups, contributing to its reactivity and potential applications in organic synthesis and materials science. The additional substituents, including a long-chain alkene with multiple methyl groups, suggest that this compound may exhibit unique physical properties such as increased hydrophobicity and potential biological activity. Its stereochemistry, indicated by the [R-[R*,S*-(E)]] notation, implies specific spatial arrangements of its atoms, which can influence its interactions in biological systems. Overall, this compound may be of interest in fields such as organic chemistry, medicinal chemistry, and materials science due to its structural complexity and potential functional properties.
Formula:C31H46O2
InChI:InChI=1S/C31H46O2/c1-22(2)12-9-13-23(3)14-10-15-24(4)16-11-17-25(5)20-21-27-26(6)30(32)28-18-7-8-19-29(28)31(27)33/h7-8,18-20,22-24H,9-17,21H2,1-6H3/b25-20+/t23-,24+/m0/s1
InChI key:InChIKey=MBWXNTAXLNYFJB-UDCSOKOMSA-N
SMILES:O=C1C=2C(C(=O)C(C)=C1C/C=C(/CCC[C@@H](CCC[C@H](CCCC(C)C)C)C)\C)=CC=CC2
Synonyms:- 1,4-Naphthalenedione, 2-methyl-3-(3,7,11,15-tetramethyl-2-hexadecenyl)-, [R-[R*,S*-(E)]]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
(2E,7R,11S)-Vitamin K1
CAS:Controlled ProductFormula:C31H46O2Color and Shape:NeatMolecular weight:450.696

