
CAS 13249-46-2
:2-Carboxy-2,5-dihydro-5-oxo-2-furanacetic acid
Description:
2-Carboxy-2,5-dihydro-5-oxo-2-furanacetic acid, with the CAS number 13249-46-2, is a chemical compound characterized by its furan ring structure, which is a five-membered aromatic ring containing oxygen. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of the keto group (5-oxo) enhances its reactivity, making it a useful intermediate in organic synthesis. The dihydro form indicates that the compound has two additional hydrogen atoms, which can influence its stability and solubility in various solvents. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical research. Its structural features suggest potential applications in the synthesis of more complex molecules or as a building block in medicinal chemistry. Overall, 2-Carboxy-2,5-dihydro-5-oxo-2-furanacetic acid is notable for its unique structure and functional groups, which can lead to diverse chemical behavior and applications.
Formula:C7H6O6
InChI:InChI=1S/C7H6O6/c8-4(9)3-7(6(11)12)2-1-5(10)13-7/h1-2H,3H2,(H,8,9)(H,11,12)
InChI key:InChIKey=DHCUIDTZCMREHG-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1(C(O)=O)OC(=O)C=C1
Synonyms:- 2-(Carboxymethyl)-5-oxo-2,5-dihydrofuran-2-carboxylic acid
- 2-Carboxy-2,5-dihydro-5-oxo-2-furanacetic acid
- 3-Butene-1,2,4-tricarboxylic acid, 2-hydroxy-, γ-lactone
- γ-Carboxymuconolactone
- 2-Furanacetic acid, 2-carboxy-2,5-dihydro-5-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
