CAS 13249-58-6
:2-Bromo-1,1-diphenylethene
Description:
2-Bromo-1,1-diphenylethene, with the CAS number 13249-58-6, is an organic compound characterized by its structure, which features a bromine atom attached to a carbon-carbon double bond that is also connected to two phenyl groups. This compound is typically a colorless to pale yellow solid at room temperature and is known for its relatively high stability due to the presence of the double bond and the steric hindrance provided by the bulky phenyl groups. It exhibits moderate solubility in organic solvents such as ethanol and dichloromethane, while being less soluble in water. The presence of the bromine atom makes it a potential candidate for various chemical reactions, including nucleophilic substitutions and eliminations. Additionally, 2-Bromo-1,1-diphenylethene can serve as a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Its reactivity and properties make it of interest in both academic research and industrial applications.
Formula:C14H11Br
InChI:InChI=1S/C14H11Br/c15-11-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-11H
InChI key:InChIKey=QRDVTIMUEDYLOC-UHFFFAOYSA-N
SMILES:C(=CBr)(C1=CC=CC=C1)C2=CC=CC=C2
Synonyms:- Benzene, 1,1′-(2-bromoethenylidene)bis-
- Benzene, 1,1'-(2-bromoethenylidene)bis-
- 1,1′-(2-Bromoethenylidene)bis[benzene]
- Benzene, 1,1′-(bromoethenylidene)bis-
- Ethylene, 2-bromo-1,1-diphenyl-
- 1,1'-(2-Bromoethene-1,1-diyl)dibenzene
- 1,1-Diphenyl-2-bromoethylene
- Ethylene, 2-bromo-1,1-diphenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
