CymitQuimica logo

CAS 13250-08-3

:

8-hydroxy-6,9a-dimethyl-3-methylidenedecahydroazuleno[4,5-b]furan-2,9-dione

Description:
8-hydroxy-6,9a-dimethyl-3-methylidenedecahydroazuleno[4,5-b]furan-2,9-dione, with the CAS number 13250-08-3, is a complex organic compound characterized by its unique fused ring structure, which includes a furan moiety and a decahydroazulene framework. This compound features multiple functional groups, including hydroxyl and carbonyl groups, contributing to its reactivity and potential biological activity. The presence of methyl groups enhances its hydrophobic character, which may influence its solubility and interaction with biological membranes. The compound's structural intricacies suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Its specific stereochemistry and functionalization may also impart unique optical properties, making it of interest in materials science. However, detailed studies on its physical properties, such as melting point, boiling point, and spectral characteristics, would be necessary to fully understand its behavior and potential applications. As with many organic compounds, safety and handling precautions should be observed due to the potential for toxicity or reactivity.
Formula:C15H20O4
InChI:InChI=1/C15H20O4/c1-7-4-5-9-8(2)14(18)19-13(9)15(3)10(7)6-11(16)12(15)17/h7,9-11,13,16H,2,4-6H2,1,3H3
SMILES:CC1CCC2C(=C)C(=O)OC2C2(C)C1CC(C2=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.