CAS 132502-93-3
:2-(Trifluoromethyl)-1H-indole-3-acetic acid
Description:
2-(Trifluoromethyl)-1H-indole-3-acetic acid, with the CAS number 132502-93-3, is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a trifluoromethyl group (-CF3) at the 2-position of the indole ring significantly influences its chemical properties, enhancing its lipophilicity and potentially affecting its biological activity. The acetic acid functional group at the 3-position contributes to its acidity and reactivity, making it a potential candidate for various chemical reactions. This compound may exhibit interesting pharmacological properties, particularly in the field of medicinal chemistry, due to the unique combination of the indole framework and the trifluoromethyl substituent. Its solubility, stability, and reactivity can be influenced by the presence of the trifluoromethyl group, which is known to impart unique electronic and steric effects. Overall, 2-(Trifluoromethyl)-1H-indole-3-acetic acid is a compound of interest for research in organic synthesis and drug development.
Formula:C11H8F3NO2
InChI:InChI=1/C11H8F3NO2/c12-11(13,14)10-7(5-9(16)17)6-3-1-2-4-8(6)15-10/h1-4,15H,5H2,(H,16,17)
SMILES:c1ccc2c(c1)c(CC(=O)O)c(C(F)(F)F)[nH]2
Synonyms:- 2-(2-(Trifluoromethyl)-1H-indol-3-yl)acetic acid
- [2-(trifluoromethyl)-1H-indol-3-yl]acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
