CAS 13251-19-9

4-amino-3-phenyl-2-thioxo-2,3-dihydro-1,3-thiazole-5-carbonitrile

Description:

4-amino-3-phenyl-2-thioxo-2,3-dihydro-1,3-thiazole-5-carbonitrile, with the CAS number 13251-19-9, is a heterocyclic compound featuring a thiazole ring, which is characterized by its sulfur and nitrogen atoms. This compound typically exhibits a range of biological activities, making it of interest in medicinal chemistry. The presence of the amino group and the phenyl substituent can influence its reactivity and solubility, while the thioxo group contributes to its potential as a nucleophile. The carbonitrile functional group may enhance its ability to participate in various chemical reactions, including nucleophilic additions and cycloadditions. Additionally, compounds of this type may exhibit antimicrobial, antifungal, or anticancer properties, although specific biological activities would depend on the structural context and substituents. Overall, the unique combination of functional groups in this compound suggests potential applications in pharmaceuticals and agrochemicals, warranting further investigation into its chemical behavior and biological efficacy.

Formula: C₁₀H₇N₃S₂

InChI: InChI=1/C10H7N3S2/c11-6-8-9(12)13(10(14)15-8)7-4-2-1-3-5-7/h1-5H,12H2

SMILES: c1ccc(cc1)n1c(c(C#N)sc1=S)N

Synonyms:

• 4-Amino-3-phenyl-2-thioxo-2,3-dihydro-thiazole-5-carbonitrile
• 5-Thiazolecarbonitrile, 4-Amino-2,3-Dihydro-3-Phenyl-2-Thioxo-