CAS 132513-53-2
:Butyl (2S)-2-hydroxyhexanoate
Description:
Butyl (2S)-2-hydroxyhexanoate, with the CAS number 132513-53-2, is an ester derived from butanol and 2-hydroxyhexanoic acid. This compound typically appears as a colorless to pale yellow liquid with a characteristic fruity odor, making it potentially useful in flavoring and fragrance applications. It is soluble in organic solvents and exhibits limited solubility in water due to its hydrophobic butyl group. The presence of the hydroxyl group contributes to its reactivity, allowing for potential participation in various chemical reactions, such as esterification and transesterification. Its chiral center (the 2S configuration) indicates that it can exist in two enantiomeric forms, which may exhibit different biological activities or sensory properties. In terms of safety, like many esters, it should be handled with care, as it may cause irritation upon contact with skin or eyes. Overall, Butyl (2S)-2-hydroxyhexanoate is of interest in both industrial applications and research settings due to its unique chemical properties.
Formula:C10H20O3
InChI:InChI=1S/C10H20O3/c1-3-5-7-9(11)10(12)13-8-6-4-2/h9,11H,3-8H2,1-2H3/t9-/m0/s1
InChI key:InChIKey=OCRIHSDKXZMSOY-VIFPVBQESA-N
SMILES:C([C@H](CCCC)O)(OCCCC)=O
Synonyms:- Hexanoic acid, 2-hydroxy-, butyl ester, (2S)-
- Hexanoic acid, 2-hydroxy-, butyl ester, (S)-
- Butyl (2S)-2-hydroxyhexanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
