CAS 13252-72-7
:3-(Hydroxyamino)benzoic acid
Description:
3-(Hydroxyamino)benzoic acid, also known as salicylhydroxamic acid, is an organic compound characterized by the presence of both a hydroxyl group and an amino group attached to a benzene ring, specifically at the meta position relative to the carboxylic acid group. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to its polar functional groups. It exhibits properties typical of both acids and amines, allowing it to participate in various chemical reactions, including those involving hydrogen bonding and coordination with metal ions. The presence of the hydroxylamino group enhances its reactivity, making it useful in various applications, including as a chelating agent in analytical chemistry and potential pharmaceutical applications. Additionally, its structural features may contribute to biological activity, making it of interest in medicinal chemistry. As with many organic compounds, handling should be done with care, considering potential toxicity and environmental impact.
Formula:C7H7NO3
InChI:InChI=1S/C7H7NO3/c9-7(10)5-2-1-3-6(4-5)8-11/h1-4,8,11H,(H,9,10)
InChI key:InChIKey=BVZASAZPMFMKCN-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(NO)=CC=C1
Synonyms:- 3-(Hydroxyamino)benzoic acid
- Benzoic acid, 3-(hydroxyamino)-
- Benzoic acid, m-(hydroxyamino)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
