CAS 13252-75-0
:3-[hydroxy(methoxy)methylidene]-2H-chromene-2,4(3H)-dione
Description:
The chemical substance known as "3-[hydroxy(methoxy)methylidene]-2H-chromene-2,4(3H)-dione," with the CAS number 13252-75-0, is a chromone derivative characterized by its unique structural features. This compound contains a chromene backbone, which is a bicyclic structure consisting of a benzene ring fused to a pyran ring. The presence of a hydroxy group and a methoxy group on the chromene structure contributes to its potential reactivity and solubility properties. The methylene bridge connecting the hydroxy and methoxy groups to the chromene core indicates the presence of a functionalized aldehyde or ketone, which may enhance its biological activity. Compounds of this nature are often studied for their potential pharmacological properties, including antioxidant, anti-inflammatory, and anticancer activities. The specific arrangement of functional groups can significantly influence the compound's chemical behavior, stability, and interactions with biological systems. Overall, this substance represents a class of compounds with diverse applications in medicinal chemistry and natural product synthesis.
Formula:C11H8O5
InChI:InChI=1/C11H8O5/c1-15-10(13)8-9(12)6-4-2-3-5-7(6)16-11(8)14/h2-5,13H,1H3
SMILES:COC(=C1C(=O)c2ccccc2OC1=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2H-1-Benzopyran-3-carboxylic acid, 4-hydroxy-2-oxo-, methyl ester
CAS:Formula:C11H8O5Molecular weight:220.1782
