CAS 132521-68-7

2-Chloro-3,4-quinolinediamine

Description:

2-Chloro-3,4-quinolinediamine is an organic compound characterized by its quinoline structure, which features a chlorine atom and two amino groups attached to the aromatic ring. This compound typically exhibits properties associated with both aromatic amines and halogenated compounds, including potential solubility in polar solvents and reactivity due to the presence of the amino groups. The chlorine substituent can influence the compound's reactivity and stability, making it a candidate for various chemical reactions, such as nucleophilic substitutions. Additionally, the amino groups can participate in hydrogen bonding and may enhance the compound's biological activity. 2-Chloro-3,4-quinolinediamine may be of interest in medicinal chemistry and materials science due to its potential applications in drug development and as a building block for synthesizing more complex molecules. Safety considerations should be taken into account when handling this compound, as it may pose health risks typical of amines and halogenated substances.

Formula: C₉H₈ClN₃

InChI: InChI=1S/C9H8ClN3/c10-9-8(12)7(11)5-3-1-2-4-6(5)13-9/h1-4H,12H2,(H2,11,13)

InChI key: InChIKey=KERSAFJGNOGGQZ-UHFFFAOYSA-N

SMILES: NC=1C2=C(N=C(Cl)C1N)C=CC=C2

Synonyms:

• 2-Chloro-3,4-quinolinediamine
• 3,4-Quinolinediamine, 2-chloro-
• 3,4-Diamino-2-chloroquinoline