CAS 132521-74-5
:Methyl 6-[4-(phenylmethyl)-1-piperazinyl]-3-pyridinecarboxylate
Description:
Methyl 6-[4-(phenylmethyl)-1-piperazinyl]-3-pyridinecarboxylate, identified by its CAS number 132521-74-5, is a chemical compound characterized by its complex structure, which includes a pyridine ring and a piperazine moiety. This compound typically exhibits properties associated with both heterocyclic and aromatic compounds, contributing to its potential biological activity. It is likely to be a white to off-white solid, soluble in organic solvents, and may have limited solubility in water due to its hydrophobic phenylmethyl group. The presence of the piperazine ring suggests potential interactions with biological targets, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure may confer specific pharmacological properties, such as receptor binding affinity or enzyme inhibition, which are essential for therapeutic applications. As with many organic compounds, proper handling and storage are crucial, as they may be sensitive to light, moisture, or temperature variations.
Formula:C18H21N3O2
InChI:InChI=1S/C18H21N3O2/c1-23-18(22)16-7-8-17(19-13-16)21-11-9-20(10-12-21)14-15-5-3-2-4-6-15/h2-8,13H,9-12,14H2,1H3
InChI key:InChIKey=YSAFROZAEXKPKD-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC=C(N=C1)N2CCN(CC3=CC=CC=C3)CC2
Synonyms:- Methyl 6-[4-(phenylmethyl)-1-piperazinyl]-3-pyridinecarboxylate
- 3-Pyridinecarboxylic acid, 6-[4-(phenylmethyl)-1-piperazinyl]-, methyl ester
- METHYL 6-(4-BENZYLPIPERAZINO)NICOTINATE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.