CAS 132521-78-9
:6-(1-Piperazinyl)-3-pyridinecarboxylic acid ethyl ester
Description:
6-(1-Piperazinyl)-3-pyridinecarboxylic acid ethyl ester, with the CAS number 132521-78-9, is a chemical compound characterized by its piperazine and pyridine moieties, which contribute to its biological activity and potential pharmacological applications. This compound typically appears as a solid or crystalline substance and is soluble in polar organic solvents. Its structure includes a pyridine ring substituted with a carboxylic acid ethyl ester group and a piperazine ring, which may enhance its interaction with biological targets, such as receptors or enzymes. The presence of the piperazine group often imparts properties such as increased lipophilicity and the ability to form hydrogen bonds, which can be crucial for drug design. Additionally, this compound may exhibit various biological activities, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, and its stability under different conditions should be evaluated for practical applications.
Formula:C12H17N3O2
InChI:InChI=1/C12H17N3O2/c1-2-17-12(16)10-3-4-11(14-9-10)15-7-5-13-6-8-15/h3-4,9,13H,2,5-8H2,1H3
SMILES:CCOC(=O)c1ccc(nc1)N1CCNCC1
Synonyms:- 132521-78-9
- Ethyl 6-Piperazin-1-Ylnicotinate
- Ethyl 6-(Piperazin-1-Yl)Pyridine-3-Carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
