
CAS 132523-48-9
:(αR)-α-(1-Methylethyl)-2-furanmethanamine
Description:
(αR)-α-(1-Methylethyl)-2-furanmethanamine, with the CAS number 132523-48-9, is a chemical compound characterized by its unique structural features, including a furan ring and an amine functional group. This compound is classified as an amine due to the presence of the amino group (-NH2), which can participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding. The furan ring contributes to its aromatic properties, potentially influencing its reactivity and stability. The presence of the isopropyl group (1-methylethyl) enhances its hydrophobic characteristics, which may affect its solubility in different solvents. Additionally, the stereochemistry indicated by the (αR) designation suggests that the compound has specific spatial arrangements that can influence its biological activity and interactions with other molecules. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and related fields. Further studies would be necessary to fully elucidate its behavior and potential applications.
Formula:C8H13NO
InChI:InChI=1S/C8H13NO/c1-6(2)8(9)7-4-3-5-10-7/h3-6,8H,9H2,1-2H3/t8-/m1/s1
InChI key:InChIKey=PXVNXKHDHZIQNP-MRVPVSSYSA-N
SMILES:[C@H](C(C)C)(N)C1=CC=CO1
Synonyms:- (αR)-α-(1-Methylethyl)-2-furanmethanamine
- (R)-1-(2-Furyl)-2-methylpropan-1-amine
- 2-Furanmethanamine, α-(1-methylethyl)-, (αR)-
- [(R)-1-(Furan-2-yl)-2-methylpropyl]amine
- 2-Furanmethanamine, α-(1-methylethyl)-, (R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.