CAS 132525-00-9
:3-PHENYL-IMIDAZO[1,2-A]PYRIDINE-2-CARBOXYLIC ACID METHYL ESTER
Description:
3-Phenyl-imidazo[1,2-a]pyridine-2-carboxylic acid methyl ester, with the CAS number 132525-00-9, is a chemical compound characterized by its complex heterocyclic structure, which includes an imidazole ring fused to a pyridine ring, along with a phenyl group and a carboxylic acid methyl ester functional group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry and drug development. The presence of the imidazole and pyridine rings suggests potential interactions with biological targets, possibly influencing enzyme activity or receptor binding. Additionally, the methyl ester functionality may enhance lipophilicity, affecting its pharmacokinetic properties. The compound's synthesis often involves multi-step organic reactions, and it may serve as a precursor or intermediate in the development of pharmaceuticals or agrochemicals. As with many heterocyclic compounds, its reactivity and stability can be influenced by the substituents on the rings, making it a subject of study in various chemical and biological contexts.
Formula:C15H12N2O2
InChI:InChI=1/C15H12N2O2/c1-19-15(18)13-14(11-7-3-2-4-8-11)17-10-6-5-9-12(17)16-13/h2-10H,1H3
SMILES:COC(=O)c1c(c2ccccc2)n2ccccc2n1
Synonyms:- Aurora Ka-416
- Methyl 3-Phenylimidazo[1,2-A]Pyridine-2-Carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
