CAS 132525-01-0

Methyl 6-bromo-3-phenylimidazo[1,2-a]pyridine-2-carboxylate

Description:

Methyl 6-bromo-3-phenylimidazo[1,2-a]pyridine-2-carboxylate is a chemical compound characterized by its complex heterocyclic structure, which includes both imidazole and pyridine rings. This compound features a bromine atom at the 6-position and a phenyl group at the 3-position of the imidazo ring, contributing to its unique reactivity and potential biological activity. The presence of the methyl ester functional group at the 2-position enhances its solubility and reactivity, making it a useful intermediate in organic synthesis. The compound is typically solid at room temperature and may exhibit moderate stability under standard conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the imidazo and pyridine moieties, which are often associated with bioactive compounds. Safety data and handling precautions should be observed, as with many brominated compounds, due to potential toxicity and environmental concerns.

Formula: C₁₅H₁₁BrN₂O₂

InChI: InChI=1S/C15H11BrN2O2/c1-20-15(19)13-14(10-5-3-2-4-6-10)18-9-11(16)7-8-12(18)17-13/h2-9H,1H3

InChI key: InChIKey=GUGFNQAYAMEJIS-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C(N2C(=N1)C=CC(Br)=C2)C3=CC=CC=C3

Synonyms:

• Imidazo[1,2-a]pyridine-2-carboxylic acid, 6-bromo-3-phenyl-, methyl ester
• Methyl 6-bromo-3-phenylimidazo[1,2-a]pyridine-2-carboxylate

Methyl 6-bromo-3-phenylimidazo[1,2-a]pyridine-2-carboxylate

CAS: 132525-01-0

Formula: C₁₅H₁₁BrN₂O₂

Molecular weight: 331.1640

Ref: IN-DA0010SK