
CAS 1325303-81-8
:3-[[(2-Fluorophenyl)sulfonyl]methyl]pyridine
Description:
3-[[(2-Fluorophenyl)sulfonyl]methyl]pyridine, identified by its CAS number 1325303-81-8, is a chemical compound characterized by its pyridine ring substituted with a sulfonyl group linked to a 2-fluorophenyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential solubility in organic solvents and moderate polarity due to the presence of the sulfonyl group. The fluorine atom in the 2-fluorophenyl group can influence the compound's electronic properties, potentially enhancing its reactivity or interaction with biological targets. Such compounds are often of interest in medicinal chemistry for their potential pharmacological activities, including anti-inflammatory or anticancer properties. The presence of the pyridine ring may also contribute to its ability to form hydrogen bonds, affecting its biological interactions. Overall, this compound's unique structure suggests a range of applications in drug development and chemical synthesis, warranting further investigation into its specific properties and potential uses.
Formula:C12H10FNO2S
InChI:InChI=1S/C12H10FNO2S/c13-11-5-1-2-6-12(11)17(15,16)9-10-4-3-7-14-8-10/h1-8H,9H2
InChI key:InChIKey=KZUDGRQSSCYJJY-UHFFFAOYSA-N
SMILES:S(CC=1C=CC=NC1)(=O)(=O)C2=C(F)C=CC=C2
Synonyms:- 3-[[(2-Fluorophenyl)sulfonyl]methyl]pyridine
- Pyridine, 3-[[(2-fluorophenyl)sulfonyl]methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.