CAS 1325304-18-4

2-(3,4-Dimethoxyphenyl)-4-phenyl-1H-imidazole-5-thiol

Description:

2-(3,4-Dimethoxyphenyl)-4-phenyl-1H-imidazole-5-thiol is a chemical compound characterized by its imidazole core, which is a five-membered heterocyclic ring containing two nitrogen atoms. This compound features a thiol (-SH) group, which imparts significant reactivity and potential for forming disulfide bonds, making it of interest in various biochemical applications. The presence of the 3,4-dimethoxyphenyl group enhances its lipophilicity and may influence its biological activity, potentially allowing for interactions with various biological targets. The phenyl substituent at the 4-position of the imidazole ring contributes to the compound's overall stability and may affect its electronic properties. This compound may exhibit antioxidant properties due to the thiol group, and its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or as a probe in biochemical assays. As with many thiol-containing compounds, it is important to handle it with care due to its potential reactivity and sensitivity to oxidation.

Formula: C₁₇H₁₆N₂O₂S

InChI: InChI=1S/C17H16N2O2S/c1-20-13-9-8-12(10-14(13)21-2)16-18-15(17(22)19-16)11-6-4-3-5-7-11/h3-10,22H,1-2H3,(H,18,19)

InChI key: InChIKey=JIXHGAICTGDTBZ-UHFFFAOYSA-N

SMILES: SC1=C(NC(=N1)C2=CC(OC)=C(OC)C=C2)C3=CC=CC=C3

Synonyms:

• 1H-Imidazole-5-thiol, 2-(3,4-dimethoxyphenyl)-4-phenyl-
• 2-(3,4-Dimethoxyphenyl)-4-phenyl-1H-imidazole-5-thiol