CAS 1325304-24-2

1,1-Dimethylethyl 2-(3-methoxyphenyl)-3-oxo-1,4,8-triazaspiro[4.5]dec-1-ene-8-carboxylate

Description:

1,1-Dimethylethyl 2-(3-methoxyphenyl)-3-oxo-1,4,8-triazaspiro[4.5]dec-1-ene-8-carboxylate, with the CAS number 1325304-24-2, is a complex organic compound characterized by its unique spirocyclic structure, which incorporates both nitrogen and carbon atoms. This compound features a triazole ring fused to a decene framework, contributing to its potential biological activity. The presence of a methoxyphenyl group enhances its lipophilicity, which may influence its solubility and interaction with biological membranes. The carboxylate functional group suggests potential for ionic interactions, making it a candidate for various chemical reactions or biological applications. Additionally, the dimethyl substituents provide steric hindrance, which can affect the compound's reactivity and stability. Overall, this compound's intricate structure and functional groups may confer interesting pharmacological properties, warranting further investigation in medicinal chemistry and drug development contexts.

Formula: C₁₉H₂₅N₃O₄

InChI: InChI=1S/C19H25N3O4/c1-18(2,3)26-17(24)22-10-8-19(9-11-22)20-15(16(23)21-19)13-6-5-7-14(12-13)25-4/h5-7,12H,8-11H2,1-4H3,(H,21,23)

InChI key: InChIKey=YSXFFYVHEPVXMH-UHFFFAOYSA-N

SMILES: O=C1NC2(N=C1C3=CC(OC)=CC=C3)CCN(C(OC(C)(C)C)=O)CC2

Synonyms:

• 1,4,8-Triazaspiro[4.5]dec-1-ene-8-carboxylic acid, 2-(3-methoxyphenyl)-3-oxo-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 2-(3-methoxyphenyl)-3-oxo-1,4,8-triazaspiro[4.5]dec-1-ene-8-carboxylate