CymitQuimica logo

CAS 1325304-82-2

:

1′-Ethylspiro[piperidine-4,2′(1′H)-quinazolin]-4′(3′H)-one

Description:
1′-Ethylspiro[piperidine-4,2′(1′H)-quinazolin]-4′(3′H)-one is a chemical compound characterized by its unique spirocyclic structure, which combines a piperidine ring with a quinazolinone moiety. This compound typically exhibits properties associated with both piperidine and quinazoline derivatives, including potential biological activity. The presence of the ethyl group contributes to its lipophilicity, which may influence its interaction with biological targets. The spiro configuration often imparts rigidity to the molecule, potentially affecting its pharmacokinetic properties. Additionally, the compound may exhibit various functional groups that can participate in hydrogen bonding, influencing solubility and reactivity. Its specific applications and biological activities would depend on further research, but compounds of this class are often investigated for their potential as pharmaceuticals, particularly in the fields of neuropharmacology and oncology. As with many synthetic organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C14H19N3O
InChI:InChI=1S/C14H19N3O/c1-2-17-12-6-4-3-5-11(12)13(18)16-14(17)7-9-15-10-8-14/h3-6,15H,2,7-10H2,1H3,(H,16,18)
InChI key:InChIKey=LYUGGDCKUPNJAT-UHFFFAOYSA-N
SMILES:C(C)N1C2(NC(=O)C=3C1=CC=CC3)CCNCC2
Synonyms:
  • Spiro[piperidine-4,2′(1′H)-quinazolin]-4′(3′H)-one, 1′-ethyl-
  • 1′-Ethylspiro[piperidine-4,2′(1′H)-quinazolin]-4′(3′H)-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.