CAS 1325304-83-3: 3-Chloro-N-[2-[(3,5-dimethyl-1H-pyrazol-1-yl)carbonyl]-3-thienyl]-N-methylbenzenesulfonamide

Description:3-Chloro-N-[2-[(3,5-dimethyl-1H-pyrazol-1-yl)carbonyl]-3-thienyl]-N-methylbenzenesulfonamide is a chemical compound characterized by its complex structure, which includes a thienyl group, a pyrazole moiety, and a sulfonamide functional group. The presence of the chloro substituent indicates that it may exhibit unique reactivity patterns, particularly in nucleophilic substitution reactions. This compound is likely to be a solid at room temperature, with potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its diverse functional groups that can interact with biological targets. The sulfonamide group is known for its antibacterial properties, while the pyrazole and thienyl components may contribute to its biological activity. Additionally, the compound's solubility and stability can be influenced by the presence of the various functional groups, making it a subject of interest for further research in drug design and synthesis. Overall, its intricate structure suggests potential for diverse applications in chemical and pharmaceutical research.

Formula:C₁₇H₁₆ClN₃O₃S₂

InChI:InChI=1S/C17H16ClN3O3S2/c1-11-9-12(2)21(19-11)17(22)16-15(7-8-25-16)20(3)26(23,24)14-6-4-5-13(18)10-14/h4-10H,1-3H3

InChI key:InChIKey=XBFIKLNBNCUNLQ-UHFFFAOYSA-N

SMILES:O=C(C=1SC=CC1N(C)S(=O)(=O)C=2C=CC=C(Cl)C2)N3N=C(C=C3C)C

• Synonyms:
• Benzenesulfonamide, 3-chloro-N-[2-[(3,5-dimethyl-1H-pyrazol-1-yl)carbonyl]-3-thienyl]-N-methyl-
• 3-Chloro-N-[2-[(3,5-dimethyl-1H-pyrazol-1-yl)carbonyl]-3-thienyl]-N-methylbenzenesulfonamide