CAS 1325305-95-0

2-Azido-N-[2-(trifluoromethyl)phenyl]acetamide

Description:

2-Azido-N-[2-(trifluoromethyl)phenyl]acetamide is a chemical compound characterized by the presence of an azido group (-N3) and a trifluoromethyl group (-CF3) attached to a phenyl ring. This compound typically exhibits properties associated with azides, such as being sensitive to heat and shock, which can lead to explosive decomposition. The trifluoromethyl group contributes to the compound's lipophilicity and can influence its reactivity and biological activity. The acetamide functional group suggests potential for hydrogen bonding, which may affect solubility in various solvents. In terms of applications, compounds like this may be utilized in organic synthesis, medicinal chemistry, or materials science, particularly in the development of pharmaceuticals or agrochemicals. Safety precautions are essential when handling this compound due to the inherent risks associated with azides. Overall, 2-Azido-N-[2-(trifluoromethyl)phenyl]acetamide is a specialized compound with unique chemical properties that make it of interest in various fields of research.

Formula: C₉H₇F₃N₄O

InChI: InChI=1S/C9H7F3N4O/c10-9(11,12)6-3-1-2-4-7(6)15-8(17)5-14-16-13/h1-4H,5H2,(H,15,17)

InChI key: InChIKey=QAMUJVOUBDZDAI-UHFFFAOYSA-N

SMILES: N(C(CN=[N+]=[N-])=O)C1=C(C(F)(F)F)C=CC=C1

Synonyms:

• 2-Azido-N-[2-(trifluoromethyl)phenyl]acetamide
• Acetamide, 2-azido-N-[2-(trifluoromethyl)phenyl]-